C27H30F3N2O3P — CID 131736997
3-[methyl-[2-(methylamino)acetyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate (PubChem CID 131736997) has the molecular formula C27H30F3N2O3P and a molecular weight of 518.52 g/mol. Its IUPAC name is 3-[methyl-[2-(methylamino)acetyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate.
| Compound Name | 3-[methyl-[2-(methylamino)acetyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 131736997 |
| Molecular Formula | C27H30F3N2O3P |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 3-[methyl-[2-(methylamino)acetyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate |
| SMILES | CNCC(=O)N(C)CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C25H30N2OP.C2HF3O2/c1-26-21-25(28)27(2)19-12-20-29(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24;3-2(4,5)1(6)7/h3-11,13-18,26H,12,19-21H2,1-2H3;(H,6,7)/q+1;/p-1 |
| InChIKey | SRKYBCYDSNWAON-UHFFFAOYSA-M |
| XLogP | 2.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|