C30H33F6N4O5P — CID 71534818
diaminomethylidene-methyl-[2-[methyl(3-triphenylphosphaniumylpropyl)amino]-2-oxoethyl]azanium;bis(2,2,2-trifluoroacetate) (PubChem CID 71534818) has the molecular formula C30H33F6N4O5P and a molecular weight of 674.58 g/mol. Its IUPAC name is diaminomethylidene-methyl-[2-[methyl(3-triphenylphosphaniumylpropyl)amino]-2-oxoethyl]azanium;bis(2,2,2-trifluoroacetate).
| Compound Name | diaminomethylidene-methyl-[2-[methyl(3-triphenylphosphaniumylpropyl)amino]-2-oxoethyl]azanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 71534818 |
| Molecular Formula | C30H33F6N4O5P |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | diaminomethylidene-methyl-[2-[methyl(3-triphenylphosphaniumylpropyl)amino]-2-oxoethyl]azanium;bis(2,2,2-trifluoroacetate) |
| SMILES | CN(CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)C[N+](C)=C(N)N.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H32N4OP.2C2HF3O2/c1-29(25(31)21-30(2)26(27)28)19-12-20-32(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24;2*3-2(4,5)1(6)7/h3-11,13-18H,12,19-21H2,1-2H3,(H3,27,28);2*(H,6,7)/q+1;;/p-1 |
| InChIKey | AARHJHURQHVKLJ-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 155.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|