C34H41F6N4O5P — CID 136927333
diaminomethylidene-[3,3-dimethyl-4-oxo-4-(4-triphenylphosphaniumylbutylamino)butyl]-methylazanium;bis(2,2,2-trifluoroacetate) (PubChem CID 136927333) has the molecular formula C34H41F6N4O5P and a molecular weight of 730.69 g/mol. Its IUPAC name is diaminomethylidene-[3,3-dimethyl-4-oxo-4-(4-triphenylphosphaniumylbutylamino)butyl]-methylazanium;bis(2,2,2-trifluoroacetate).
| Compound Name | diaminomethylidene-[3,3-dimethyl-4-oxo-4-(4-triphenylphosphaniumylbutylamino)butyl]-methylazanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 136927333 |
| Molecular Formula | C34H41F6N4O5P |
| Molecular Weight | 730.69 g/mol |
| Exact Mass | 730.27 |
| IUPAC Name | diaminomethylidene-[3,3-dimethyl-4-oxo-4-(4-triphenylphosphaniumylbutylamino)butyl]-methylazanium;bis(2,2,2-trifluoroacetate) |
| SMILES | C[N+](CCC(C)(C)C(=O)NCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)=C(N)N.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H39N4OP.2C2HF3O2/c1-30(2,21-23-34(3)29(31)32)28(35)33-22-13-14-24-36(25-15-7-4-8-16-25,26-17-9-5-10-18-26)27-19-11-6-12-20-27;2*3-2(4,5)1(6)7/h4-12,15-20H,13-14,21-24H2,1-3H3,(H3-,31,32,33,35);2*(H,6,7) |
| InChIKey | POJABMRADBTAJQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 164.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|