C29H31F6N4O5P — CID 71534816
diaminomethylidene-methyl-[2-oxo-2-(3-triphenylphosphaniumylpropylamino)ethyl]azanium;bis(2,2,2-trifluoroacetate) (PubChem CID 71534816) has the molecular formula C29H31F6N4O5P and a molecular weight of 660.55 g/mol. Its IUPAC name is diaminomethylidene-methyl-[2-oxo-2-(3-triphenylphosphaniumylpropylamino)ethyl]azanium;bis(2,2,2-trifluoroacetate).
| Compound Name | diaminomethylidene-methyl-[2-oxo-2-(3-triphenylphosphaniumylpropylamino)ethyl]azanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 71534816 |
| Molecular Formula | C29H31F6N4O5P |
| Molecular Weight | 660.55 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | diaminomethylidene-methyl-[2-oxo-2-(3-triphenylphosphaniumylpropylamino)ethyl]azanium;bis(2,2,2-trifluoroacetate) |
| SMILES | C[N+](CC(=O)NCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)=C(N)N.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C25H29N4OP.2C2HF3O2/c1-29(25(26)27)20-24(30)28-18-11-19-31(21-12-5-2-6-13-21,22-14-7-3-8-15-22)23-16-9-4-10-17-23;2*3-2(4,5)1(6)7/h2-10,12-17H,11,18-20H2,1H3,(H3-,26,27,28,30);2*(H,6,7) |
| InChIKey | SFMPPDXMQDTJDG-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 164.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.55 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|