C38H48F3N4O7P — CID 131737000
3-[[2-[[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-methylamino]acetyl]-methylamino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate (PubChem CID 131737000) has the molecular formula C38H48F3N4O7P and a molecular weight of 760.79 g/mol. Its IUPAC name is 3-[[2-[[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-methylamino]acetyl]-methylamino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate.
| Compound Name | 3-[[2-[[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-methylamino]acetyl]-methylamino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 131737000 |
| Molecular Formula | C38H48F3N4O7P |
| Molecular Weight | 760.79 g/mol |
| Exact Mass | 760.32 |
| IUPAC Name | 3-[[2-[[N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-methylamino]acetyl]-methylamino]propyl-triphenylphosphanium;2,2,2-trifluoroacetate |
| SMILES | CN(CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)CN(C)C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C36H47N4O5P.C2HF3O2/c1-35(2,3)44-33(42)37-32(38-34(43)45-36(4,5)6)40(8)27-31(41)39(7)25-18-26-46(28-19-12-9-13-20-28,29-21-14-10-15-22-29)30-23-16-11-17-24-30;3-2(4,5)1(6)7/h9-17,19-24H,18,25-27H2,1-8H3;(H,6,7) |
| InChIKey | YDLQYBXFUZHTRC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|