C30H33F6N4O5P — CID 140662757
diaminomethylidene-methyl-[2-[methyl-[3-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]propyl]amino]-2-oxoethyl]azanium;2,2,2-trifluoroacetate (PubChem CID 140662757) has the molecular formula C30H33F6N4O5P and a molecular weight of 674.58 g/mol. Its IUPAC name is diaminomethylidene-methyl-[2-[methyl-[3-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]propyl]amino]-2-oxoethyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | diaminomethylidene-methyl-[2-[methyl-[3-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]propyl]amino]-2-oxoethyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140662757 |
| Molecular Formula | C30H33F6N4O5P |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | diaminomethylidene-methyl-[2-[methyl-[3-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]propyl]amino]-2-oxoethyl]azanium;2,2,2-trifluoroacetate |
| SMILES | CN(CCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)C[N+](C)=C(N)N.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H32F3N4O3P.C2HF3O2/c1-34(25(36)21-35(2)27(32)33)19-12-20-39(22-13-6-3-7-14-22,23-15-8-4-9-16-23,24-17-10-5-11-18-24)38-26(37)28(29,30)31;3-2(4,5)1(6)7/h3-11,13-18H,12,19-21H2,1-2H3,(H3,32,33);(H,6,7) |
| InChIKey | FRBUDNQQRMYHBW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 141.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|