C27H30F3N2O3P — CID 140662777
[3-[methyl-[2-(methylamino)acetyl]amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate (PubChem CID 140662777) has the molecular formula C27H30F3N2O3P and a molecular weight of 518.52 g/mol. Its IUPAC name is [3-[methyl-[2-(methylamino)acetyl]amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[methyl-[2-(methylamino)acetyl]amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140662777 |
| Molecular Formula | C27H30F3N2O3P |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [3-[methyl-[2-(methylamino)acetyl]amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate |
| SMILES | CNCC(=O)N(C)CCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30F3N2O3P/c1-31-21-25(33)32(2)19-12-20-36(22-13-6-3-7-14-22,23-15-8-4-9-16-23,24-17-10-5-11-18-24)35-26(34)27(28,29)30/h3-11,13-18,31H,12,19-21H2,1-2H3 |
| InChIKey | ACOODJFTGADKPC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|