C28H33F3N4O3P+ — CID 140662758
diaminomethylidene-methyl-[2-[methyl-[3-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]propyl]amino]-2-oxoethyl]azanium (PubChem CID 140662758) has the molecular formula C28H33F3N4O3P+ and a molecular weight of 561.57 g/mol. Its IUPAC name is diaminomethylidene-methyl-[2-[methyl-[3-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]propyl]amino]-2-oxoethyl]azanium.
| Compound Name | diaminomethylidene-methyl-[2-[methyl-[3-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]propyl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 140662758 |
| Molecular Formula | C28H33F3N4O3P+ |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | diaminomethylidene-methyl-[2-[methyl-[3-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]propyl]amino]-2-oxoethyl]azanium |
| SMILES | CN(CCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)C[N+](C)=C(N)N |
| InChI | InChI=1S/C28H32F3N4O3P/c1-34(25(36)21-35(2)27(32)33)19-12-20-39(22-13-6-3-7-14-22,23-15-8-4-9-16-23,24-17-10-5-11-18-24)38-26(37)28(29,30)31/h3-11,13-18H,12,19-21H2,1-2H3,(H3,32,33)/p+1 |
| InChIKey | ISNWVTHZHFQJSO-UHFFFAOYSA-O |
| XLogP | 2.30 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|