C50H52F6N4O6P2 — CID 140698652
[3-[(2-aminoacetyl)amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate (PubChem CID 140698652) has the molecular formula C50H52F6N4O6P2 and a molecular weight of 980.92 g/mol. Its IUPAC name is [3-[(2-aminoacetyl)amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[(2-aminoacetyl)amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140698652 |
| Molecular Formula | C50H52F6N4O6P2 |
| Molecular Weight | 980.92 g/mol |
| Exact Mass | 980.33 |
| IUPAC Name | [3-[(2-aminoacetyl)amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate |
| SMILES | NCC(=O)NCCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1.NCC(=O)NCCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C25H26F3N2O3P/c2*26-25(27,28)24(32)33-34(20-11-4-1-5-12-20,21-13-6-2-7-14-21,22-15-8-3-9-16-22)18-10-17-30-23(31)19-29/h2*1-9,11-16H,10,17-19,29H2,(H,30,31) |
| InChIKey | ZQIWAOOFDITKPN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.92 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|