C25H26F3N2O3P — CID 140698653
[3-[(2-aminoacetyl)amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate (PubChem CID 140698653) has the molecular formula C25H26F3N2O3P and a molecular weight of 490.46 g/mol. Its IUPAC name is [3-[(2-aminoacetyl)amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[(2-aminoacetyl)amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140698653 |
| Molecular Formula | C25H26F3N2O3P |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | [3-[(2-aminoacetyl)amino]propyl-triphenyl-λ5-phosphanyl] 2,2,2-trifluoroacetate |
| SMILES | NCC(=O)NCCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26F3N2O3P/c26-25(27,28)24(32)33-34(20-11-4-1-5-12-20,21-13-6-2-7-14-21,22-15-8-3-9-16-22)18-10-17-30-23(31)19-29/h1-9,11-16H,10,17-19,29H2,(H,30,31) |
| InChIKey | GIQZYOHBGCPUAE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|