C31H37F3NO4P — CID 142458592
10-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]decylcarbamic acid (PubChem CID 142458592) has the molecular formula C31H37F3NO4P and a molecular weight of 575.61 g/mol. Its IUPAC name is 10-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]decylcarbamic acid.
| Compound Name | 10-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]decylcarbamic acid |
|---|---|
| PubChem CID | 142458592 |
| Molecular Formula | C31H37F3NO4P |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | 10-[triphenyl-(2,2,2-trifluoroacetyl)oxy-λ5-phosphanyl]decylcarbamic acid |
| SMILES | O=C(O)NCCCCCCCCCCP(OC(=O)C(F)(F)F)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H37F3NO4P/c32-31(33,34)29(36)39-40(26-18-10-7-11-19-26,27-20-12-8-13-21-27,28-22-14-9-15-23-28)25-17-6-4-2-1-3-5-16-24-35-30(37)38/h7-15,18-23,35H,1-6,16-17,24-25H2,(H,37,38) |
| InChIKey | MCERYNTYBLSUSC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|