C27H33BrNO2P — CID 142458597
8-[bromo(triphenyl)-λ5-phosphanyl]octylcarbamic acid (PubChem CID 142458597) has the molecular formula C27H33BrNO2P and a molecular weight of 514.44 g/mol. Its IUPAC name is 8-[bromo(triphenyl)-λ5-phosphanyl]octylcarbamic acid.
| Compound Name | 8-[bromo(triphenyl)-λ5-phosphanyl]octylcarbamic acid |
|---|---|
| PubChem CID | 142458597 |
| Molecular Formula | C27H33BrNO2P |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 8-[bromo(triphenyl)-λ5-phosphanyl]octylcarbamic acid |
| SMILES | O=C(O)NCCCCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33BrNO2P/c28-32(24-16-8-5-9-17-24,25-18-10-6-11-19-25,26-20-12-7-13-21-26)23-15-4-2-1-3-14-22-29-27(30)31/h5-13,16-21,29H,1-4,14-15,22-23H2,(H,30,31) |
| InChIKey | VWTPKZGNXOKWNW-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|