C29H37BrNO2P — CID 140608055
tert-butyl N-[6-[bromo(triphenyl)-λ5-phosphanyl]hexyl]carbamate (PubChem CID 140608055) has the molecular formula C29H37BrNO2P and a molecular weight of 542.50 g/mol. Its IUPAC name is tert-butyl N-[6-[bromo(triphenyl)-λ5-phosphanyl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[bromo(triphenyl)-λ5-phosphanyl]hexyl]carbamate |
|---|---|
| PubChem CID | 140608055 |
| Molecular Formula | C29H37BrNO2P |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | tert-butyl N-[6-[bromo(triphenyl)-λ5-phosphanyl]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H37BrNO2P/c1-29(2,3)33-28(32)31-23-15-4-5-16-24-34(30,25-17-9-6-10-18-25,26-19-11-7-12-20-26)27-21-13-8-14-22-27/h6-14,17-22H,4-5,15-16,23-24H2,1-3H3,(H,31,32) |
| InChIKey | ZIMBFMXCXZRGEB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|