C27H30FNO2P+ — CID 175001461
[3-fluoro-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]prop-2-enyl]-triphenylphosphanium (PubChem CID 175001461) has the molecular formula C27H30FNO2P+ and a molecular weight of 450.51 g/mol. Its IUPAC name is [3-fluoro-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]prop-2-enyl]-triphenylphosphanium.
| Compound Name | [3-fluoro-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]prop-2-enyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 175001461 |
| Molecular Formula | C27H30FNO2P+ |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [3-fluoro-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]prop-2-enyl]-triphenylphosphanium |
| SMILES | CC(C)(C)OC(=O)NCC(=CF)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29FNO2P/c1-27(2,3)31-26(30)29-20-22(19-28)21-32(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-19H,20-21H2,1-3H3/p+1 |
| InChIKey | ZAVFNUQSFCMTSM-UHFFFAOYSA-O |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|