C30H30F9NO2P+ — CID 158989820
4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-tris[4-(trifluoromethyl)phenyl]phosphanium (PubChem CID 158989820) has the molecular formula C30H30F9NO2P+ and a molecular weight of 638.53 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-tris[4-(trifluoromethyl)phenyl]phosphanium.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-tris[4-(trifluoromethyl)phenyl]phosphanium |
|---|---|
| PubChem CID | 158989820 |
| Molecular Formula | C30H30F9NO2P+ |
| Molecular Weight | 638.53 g/mol |
| Exact Mass | 638.19 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl-tris[4-(trifluoromethyl)phenyl]phosphanium |
| SMILES | CC(C)(C)OC(=O)NCCCC[P+](c1ccc(C(F)(F)F)cc1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C30H29F9NO2P/c1-27(2,3)42-26(41)40-18-4-5-19-43(23-12-6-20(7-13-23)28(31,32)33,24-14-8-21(9-15-24)29(34,35)36)25-16-10-22(11-17-25)30(37,38)39/h6-17H,4-5,18-19H2,1-3H3/p+1 |
| InChIKey | JQADANBUVXYZFR-UHFFFAOYSA-O |
| XLogP | 8.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.53 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|