C25H28NO2P — CID 164679044
tert-butyl N-[(1S)-2-diphenylphosphanyl-1-phenylethyl]carbamate (PubChem CID 164679044) has the molecular formula C25H28NO2P and a molecular weight of 405.48 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-diphenylphosphanyl-1-phenylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-diphenylphosphanyl-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 164679044 |
| Molecular Formula | C25H28NO2P |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | tert-butyl N-[(1S)-2-diphenylphosphanyl-1-phenylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CP(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28NO2P/c1-25(2,3)28-24(27)26-23(20-13-7-4-8-14-20)19-29(21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,23H,19H2,1-3H3,(H,26,27)/t23-/m1/s1 |
| InChIKey | ZBIOGSCSDMTYHM-HSZRJFAPSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|