C22H26NO3P — CID 139092992
(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,1-diphenyl-3,4-dihydro-2H-phosphinin-1-ium-5-olate (PubChem CID 139092992) has the molecular formula C22H26NO3P and a molecular weight of 383.43 g/mol. Its IUPAC name is (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,1-diphenyl-3,4-dihydro-2H-phosphinin-1-ium-5-olate.
| Compound Name | (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,1-diphenyl-3,4-dihydro-2H-phosphinin-1-ium-5-olate |
|---|---|
| PubChem CID | 139092992 |
| Molecular Formula | C22H26NO3P |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1,1-diphenyl-3,4-dihydro-2H-phosphinin-1-ium-5-olate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[P+](c2ccccc2)(c2ccccc2)C=C1[O-] |
| InChI | InChI=1S/C22H26NO3P/c1-22(2,3)26-21(25)23-19-14-15-27(16-20(19)24,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,19H,14-15H2,1-3H3,(H-,23,24,25)/t19-/m0/s1 |
| InChIKey | IWAWJKKTSXXBJG-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|