C29H37INO2P — CID 19380951
tert-butyl piperidine-1-carboxylate;methyl(triphenyl)phosphanium;iodide (PubChem CID 19380951) has the molecular formula C29H37INO2P and a molecular weight of 589.50 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;methyl(triphenyl)phosphanium;iodide.
| Compound Name | tert-butyl piperidine-1-carboxylate;methyl(triphenyl)phosphanium;iodide |
|---|---|
| PubChem CID | 19380951 |
| Molecular Formula | C29H37INO2P |
| Molecular Weight | 589.50 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;methyl(triphenyl)phosphanium;iodide |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| InChI | InChI=1S/C19H18P.C10H19NO2.HI/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-10(2,3)13-9(12)11-7-5-4-6-8-11;/h2-16H,1H3;4-8H2,1-3H3;1H/q+1;;/p-1 |
| InChIKey | VQQNIEVRURBWTA-UHFFFAOYSA-M |
| XLogP | 3.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|