C33H35NO2P2 — CID 85298166
tert-butyl 2,4-bis(diphenylphosphanyl)pyrrolidine-1-carboxylate (PubChem CID 85298166) has the molecular formula C33H35NO2P2 and a molecular weight of 539.60 g/mol. Its IUPAC name is tert-butyl 2,4-bis(diphenylphosphanyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2,4-bis(diphenylphosphanyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 85298166 |
| Molecular Formula | C33H35NO2P2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | tert-butyl 2,4-bis(diphenylphosphanyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(P(c2ccccc2)c2ccccc2)CC1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35NO2P2/c1-33(2,3)36-32(35)34-25-30(37(26-16-8-4-9-17-26)27-18-10-5-11-19-27)24-31(34)38(28-20-12-6-13-21-28)29-22-14-7-15-23-29/h4-23,30-31H,24-25H2,1-3H3 |
| InChIKey | KDQCEKWIVBXWAK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|