C26H31BrNO2P — CID 140608051
tert-butyl N-[3-[bromo(triphenyl)-λ5-phosphanyl]propyl]carbamate (PubChem CID 140608051) has the molecular formula C26H31BrNO2P and a molecular weight of 500.42 g/mol. Its IUPAC name is tert-butyl N-[3-[bromo(triphenyl)-λ5-phosphanyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[bromo(triphenyl)-λ5-phosphanyl]propyl]carbamate |
|---|---|
| PubChem CID | 140608051 |
| Molecular Formula | C26H31BrNO2P |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | tert-butyl N-[3-[bromo(triphenyl)-λ5-phosphanyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H31BrNO2P/c1-26(2,3)30-25(29)28-20-13-21-31(27,22-14-7-4-8-15-22,23-16-9-5-10-17-23)24-18-11-6-12-19-24/h4-12,14-19H,13,20-21H2,1-3H3,(H,28,29) |
| InChIKey | AAUDFHABCBSYRU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|