C27H33BrNO2P — CID 158860457
8-(carboxyamino)octyl-triphenylphosphanium bromide (PubChem CID 158860457) has the molecular formula C27H33BrNO2P and a molecular weight of 514.44 g/mol. Its IUPAC name is 8-(carboxyamino)octyl-triphenylphosphanium bromide.
| Compound Name | 8-(carboxyamino)octyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 158860457 |
| Molecular Formula | C27H33BrNO2P |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 8-(carboxyamino)octyl-triphenylphosphanium bromide |
| SMILES | O=C(O)NCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C27H32NO2P.BrH/c29-27(30)28-22-14-3-1-2-4-15-23-31(24-16-8-5-9-17-24,25-18-10-6-11-19-25)26-20-12-7-13-21-26;/h5-13,16-21,28H,1-4,14-15,22-23H2;1H |
| InChIKey | JAOXNQMMAGBLMR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|