C28H35BrNO2P — CID 142458601
9-[bromo(triphenyl)-λ5-phosphanyl]nonylcarbamic acid (PubChem CID 142458601) has the molecular formula C28H35BrNO2P and a molecular weight of 528.47 g/mol. Its IUPAC name is 9-[bromo(triphenyl)-λ5-phosphanyl]nonylcarbamic acid.
| Compound Name | 9-[bromo(triphenyl)-λ5-phosphanyl]nonylcarbamic acid |
|---|---|
| PubChem CID | 142458601 |
| Molecular Formula | C28H35BrNO2P |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 9-[bromo(triphenyl)-λ5-phosphanyl]nonylcarbamic acid |
| SMILES | O=C(O)NCCCCCCCCCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35BrNO2P/c29-33(25-17-9-6-10-18-25,26-19-11-7-12-20-26,27-21-13-8-14-22-27)24-16-5-3-1-2-4-15-23-30-28(31)32/h6-14,17-22,30H,1-5,15-16,23-24H2,(H,31,32) |
| InChIKey | JYDICRMETHBORN-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|