C9H10F3N2O4- — CID 122407757
1-(3-aminopropyl)pyrrole-2,5-dione;2,2,2-trifluoroacetate (PubChem CID 122407757) has the molecular formula C9H10F3N2O4- and a molecular weight of 267.18 g/mol. Its IUPAC name is 1-(3-aminopropyl)pyrrole-2,5-dione;2,2,2-trifluoroacetate.
| Compound Name | 1-(3-aminopropyl)pyrrole-2,5-dione;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 122407757 |
| Molecular Formula | C9H10F3N2O4- |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(3-aminopropyl)pyrrole-2,5-dione;2,2,2-trifluoroacetate |
| SMILES | NCCCN1C(=O)C=CC1=O.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H10N2O2.C2HF3O2/c8-4-1-5-9-6(10)2-3-7(9)11;3-2(4,5)1(6)7/h2-3H,1,4-5,8H2;(H,6,7)/p-1 |
| InChIKey | KXQYFSRZPNLIDW-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|