C12H14BrNO6 — CID 143162840
2-[3-(2,5-dioxopyrrol-1-yl)propanoyloxy]ethyl 2-bromopropanoate (PubChem CID 143162840) has the molecular formula C12H14BrNO6 and a molecular weight of 348.15 g/mol. Its IUPAC name is 2-[3-(2,5-dioxopyrrol-1-yl)propanoyloxy]ethyl 2-bromopropanoate.
| Compound Name | 2-[3-(2,5-dioxopyrrol-1-yl)propanoyloxy]ethyl 2-bromopropanoate |
|---|---|
| PubChem CID | 143162840 |
| Molecular Formula | C12H14BrNO6 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2-[3-(2,5-dioxopyrrol-1-yl)propanoyloxy]ethyl 2-bromopropanoate |
| SMILES | CC(Br)C(=O)OCCOC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H14BrNO6/c1-8(13)12(18)20-7-6-19-11(17)4-5-14-9(15)2-3-10(14)16/h2-3,8H,4-7H2,1H3 |
| InChIKey | LEXSUNJKPOJZCJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|