C35H53NO5 — CID 53309109
2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl (4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoate (PubChem CID 53309109) has the molecular formula C35H53NO5 and a molecular weight of 567.81 g/mol. Its IUPAC name is 2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl (4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoate.
| Compound Name | 2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl (4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoate |
|---|---|
| PubChem CID | 53309109 |
| Molecular Formula | C35H53NO5 |
| Molecular Weight | 567.81 g/mol |
| Exact Mass | 567.39 |
| IUPAC Name | 2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethyl (4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC(=O)OCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C35H53NO5/c1-28(2)12-9-15-31(5)18-10-16-29(3)13-7-8-14-30(4)17-11-19-32(6)20-23-35(39)41-27-26-40-25-24-36-33(37)21-22-34(36)38/h12-14,18-19,21-22H,7-11,15-17,20,23-27H2,1-6H3/b29-13+,30-14+,31-18+,32-19+ |
| InChIKey | ABXFTTMNMVDOFA-XNWKSVSASA-N |
| XLogP | 8.12 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.81 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|