C16H22N2O8 — CID 174244463
[methyl(4-oxobutanoyl)amino] 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate (PubChem CID 174244463) has the molecular formula C16H22N2O8 and a molecular weight of 370.36 g/mol. Its IUPAC name is [methyl(4-oxobutanoyl)amino] 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate.
| Compound Name | [methyl(4-oxobutanoyl)amino] 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 174244463 |
| Molecular Formula | C16H22N2O8 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [methyl(4-oxobutanoyl)amino] 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate |
| SMILES | CN(OC(=O)CCOCCOCCN1C(=O)C=CC1=O)C(=O)CCC=O |
| InChI | InChI=1S/C16H22N2O8/c1-17(13(20)3-2-8-19)26-16(23)6-9-24-11-12-25-10-7-18-14(21)4-5-15(18)22/h4-5,8H,2-3,6-7,9-12H2,1H3 |
| InChIKey | NSLWPSWVPJLJMB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|