C16H24N2O6 — CID 178144150
1-hexylpyrrole-2,5-dione;[methyl(4-oxobutanoyl)amino] formate (PubChem CID 178144150) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-hexylpyrrole-2,5-dione;[methyl(4-oxobutanoyl)amino] formate.
| Compound Name | 1-hexylpyrrole-2,5-dione;[methyl(4-oxobutanoyl)amino] formate |
|---|---|
| PubChem CID | 178144150 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-hexylpyrrole-2,5-dione;[methyl(4-oxobutanoyl)amino] formate |
| SMILES | CCCCCCN1C(=O)C=CC1=O.CN(OC=O)C(=O)CCC=O |
| InChI | InChI=1S/C10H15NO2.C6H9NO4/c1-2-3-4-5-8-11-9(12)6-7-10(11)13;1-7(11-5-9)6(10)3-2-4-8/h6-7H,2-5,8H2,1H3;4-5H,2-3H2,1H3 |
| InChIKey | IZOBKUBOSVATCU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|