C27H30N2O7 — CID 163928697
4-[(5-benzyl-2,4-dioxo-3-phenyl-1H-pyrimidin-6-yl)oxycarbonyloxy]butyl 2-methylbutanoate (PubChem CID 163928697) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is 4-[(5-benzyl-2,4-dioxo-3-phenyl-1H-pyrimidin-6-yl)oxycarbonyloxy]butyl 2-methylbutanoate.
| Compound Name | 4-[(5-benzyl-2,4-dioxo-3-phenyl-1H-pyrimidin-6-yl)oxycarbonyloxy]butyl 2-methylbutanoate |
|---|---|
| PubChem CID | 163928697 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 4-[(5-benzyl-2,4-dioxo-3-phenyl-1H-pyrimidin-6-yl)oxycarbonyloxy]butyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCOC(=O)Oc1[nH]c(=O)n(-c2ccccc2)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C27H30N2O7/c1-3-19(2)25(31)34-16-10-11-17-35-27(33)36-23-22(18-20-12-6-4-7-13-20)24(30)29(26(32)28-23)21-14-8-5-9-15-21/h4-9,12-15,19H,3,10-11,16-18H2,1-2H3,(H,28,32) |
| InChIKey | RGUHBHWRIBKVAI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|