C30H26N2O7 — CID 121449822
2-(1,5-dibenzyl-2,6-dioxo-3-phenylpyrimidin-4-yl)oxycarbonyloxyethyl prop-2-enoate (PubChem CID 121449822) has the molecular formula C30H26N2O7 and a molecular weight of 526.55 g/mol. Its IUPAC name is 2-(1,5-dibenzyl-2,6-dioxo-3-phenylpyrimidin-4-yl)oxycarbonyloxyethyl prop-2-enoate.
| Compound Name | 2-(1,5-dibenzyl-2,6-dioxo-3-phenylpyrimidin-4-yl)oxycarbonyloxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 121449822 |
| Molecular Formula | C30H26N2O7 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 2-(1,5-dibenzyl-2,6-dioxo-3-phenylpyrimidin-4-yl)oxycarbonyloxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)Oc1c(Cc2ccccc2)c(=O)n(Cc2ccccc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H26N2O7/c1-2-26(33)37-18-19-38-30(36)39-28-25(20-22-12-6-3-7-13-22)27(34)31(21-23-14-8-4-9-15-23)29(35)32(28)24-16-10-5-11-17-24/h2-17H,1,18-21H2 |
| InChIKey | KHWJWCZOORXZBU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|