C33H40N2O8 — CID 138525415
4-O-(3,5-dibenzyl-2,4-dioxo-1H-pyrimidin-6-yl) 1-O-[2-(4-methyl-2-propan-2-ylpentanoyl)oxyethyl] butanedioate (PubChem CID 138525415) has the molecular formula C33H40N2O8 and a molecular weight of 592.69 g/mol. Its IUPAC name is 4-O-(3,5-dibenzyl-2,4-dioxo-1H-pyrimidin-6-yl) 1-O-[2-(4-methyl-2-propan-2-ylpentanoyl)oxyethyl] butanedioate.
| Compound Name | 4-O-(3,5-dibenzyl-2,4-dioxo-1H-pyrimidin-6-yl) 1-O-[2-(4-methyl-2-propan-2-ylpentanoyl)oxyethyl] butanedioate |
|---|---|
| PubChem CID | 138525415 |
| Molecular Formula | C33H40N2O8 |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 4-O-(3,5-dibenzyl-2,4-dioxo-1H-pyrimidin-6-yl) 1-O-[2-(4-methyl-2-propan-2-ylpentanoyl)oxyethyl] butanedioate |
| SMILES | CC(C)CC(C(=O)OCCOC(=O)CCC(=O)Oc1[nH]c(=O)n(Cc2ccccc2)c(=O)c1Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C33H40N2O8/c1-22(2)19-26(23(3)4)32(39)42-18-17-41-28(36)15-16-29(37)43-30-27(20-24-11-7-5-8-12-24)31(38)35(33(40)34-30)21-25-13-9-6-10-14-25/h5-14,22-23,26H,15-21H2,1-4H3,(H,34,40) |
| InChIKey | WHCYMBJHSRARPN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|