C18H19N2O8- — CID 22252192
5-benzyl-3-[2-(3-carboxypropanoyloxy)ethoxymethyl]-2,6-dioxopyrimidin-4-olate (PubChem CID 22252192) has the molecular formula C18H19N2O8- and a molecular weight of 391.36 g/mol. Its IUPAC name is 5-benzyl-3-[2-(3-carboxypropanoyloxy)ethoxymethyl]-2,6-dioxopyrimidin-4-olate.
| Compound Name | 5-benzyl-3-[2-(3-carboxypropanoyloxy)ethoxymethyl]-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 22252192 |
| Molecular Formula | C18H19N2O8- |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 5-benzyl-3-[2-(3-carboxypropanoyloxy)ethoxymethyl]-2,6-dioxopyrimidin-4-olate |
| SMILES | O=C(O)CCC(=O)OCCOCn1c([O-])c(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H20N2O8/c21-14(22)6-7-15(23)28-9-8-27-11-20-17(25)13(16(24)19-18(20)26)10-12-4-2-1-3-5-12/h1-5,25H,6-11H2,(H,21,22)(H,19,24,26)/p-1 |
| InChIKey | XXABMAUXRICHNU-UHFFFAOYSA-M |
| XLogP | -0.42 |
| TPSA | 150.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|