C20H34N2O4 — CID 170126642
6-(6-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-ethyl-2,4-dimethylpentanoate (PubChem CID 170126642) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 6-(6-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-ethyl-2,4-dimethylpentanoate.
| Compound Name | 6-(6-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-ethyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 170126642 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 6-(6-methyl-2,4-dioxopyrimidin-1-yl)hexyl 2-ethyl-2,4-dimethylpentanoate |
| SMILES | CCC(C)(CC(C)C)C(=O)OCCCCCCn1c(C)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C20H34N2O4/c1-6-20(5,14-15(2)3)18(24)26-12-10-8-7-9-11-22-16(4)13-17(23)21-19(22)25/h13,15H,6-12,14H2,1-5H3,(H,21,23,25) |
| InChIKey | ZXCRFWHNPVQWTE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|