About 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate
2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate (PubChem CID 162556253) has the molecular formula C14H25F3O2
and a molecular weight of 282.35 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate.
Analyze 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate?
The IUPAC name of 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate (CID 162556253) is 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate?
The canonical SMILES for 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate is CCCC(C)C(C)(CC(C)C)C(=O)OCC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate?
The InChIKey is MLPFNABBBXTVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F3O2/c1-6-7-11(4)13(5,8-10(2)3)12(18)19-9-14(15,16)17/h10-11H,6-9H2,1-5H3.
What are the key properties of 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate?
2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate has a molecular weight of 282.35 g/mol, XLogP of 4.58, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2,3-dimethyl-2-(2-methylpropyl)hexanoate is sourced from PubChem (CID 162556253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).