C17H26F8O2 — CID 163585067
[2-(1,2-difluoroethyl)-2,3,3,4,4,5-hexafluoropentyl] 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 163585067) has the molecular formula C17H26F8O2 and a molecular weight of 414.38 g/mol. Its IUPAC name is [2-(1,2-difluoroethyl)-2,3,3,4,4,5-hexafluoropentyl] 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [2-(1,2-difluoroethyl)-2,3,3,4,4,5-hexafluoropentyl] 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 163585067 |
| Molecular Formula | C17H26F8O2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [2-(1,2-difluoroethyl)-2,3,3,4,4,5-hexafluoropentyl] 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OCC(F)(C(F)CF)C(F)(F)C(F)(F)CF)C(C)C |
| InChI | InChI=1S/C17H26F8O2/c1-10(2)6-14(5,11(3)4)13(26)27-9-15(21,12(20)7-18)17(24,25)16(22,23)8-19/h10-12H,6-9H2,1-5H3 |
| InChIKey | GKUIITRZJGERLJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|