C31H52F6O5 — CID 130177749
6-[1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl-2-(2,2-dimethylpropyl)-2,3,4,4,6,7-hexamethyloctanoic acid (PubChem CID 130177749) has the molecular formula C31H52F6O5 and a molecular weight of 618.74 g/mol. Its IUPAC name is 6-[1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl-2-(2,2-dimethylpropyl)-2,3,4,4,6,7-hexamethyloctanoic acid.
| Compound Name | 6-[1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl-2-(2,2-dimethylpropyl)-2,3,4,4,6,7-hexamethyloctanoic acid |
|---|---|
| PubChem CID | 130177749 |
| Molecular Formula | C31H52F6O5 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | 6-[1-cyclohexyl-4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonyl-2-(2,2-dimethylpropyl)-2,3,4,4,6,7-hexamethyloctanoic acid |
| SMILES | CC(C)C(C)(CC(C)(C)C(C)C(C)(CC(C)(C)C)C(=O)O)C(=O)OC(CC(O)(C(F)(F)F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C31H52F6O5/c1-19(2)27(9,18-26(7,8)20(3)28(10,23(38)39)17-25(4,5)6)24(40)42-22(21-14-12-11-13-15-21)16-29(41,30(32,33)34)31(35,36)37/h19-22,41H,11-18H2,1-10H3,(H,38,39) |
| InChIKey | LDVBSSOWJZFQHW-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |