C15H19F6O3- — CID 154081678
4-cyclohexyl-7,7,7-trifluoro-6-hydroxy-2-methyl-6-(trifluoromethyl)hept-2-enoate (PubChem CID 154081678) has the molecular formula C15H19F6O3- and a molecular weight of 361.30 g/mol. Its IUPAC name is 4-cyclohexyl-7,7,7-trifluoro-6-hydroxy-2-methyl-6-(trifluoromethyl)hept-2-enoate.
| Compound Name | 4-cyclohexyl-7,7,7-trifluoro-6-hydroxy-2-methyl-6-(trifluoromethyl)hept-2-enoate |
|---|---|
| PubChem CID | 154081678 |
| Molecular Formula | C15H19F6O3- |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-cyclohexyl-7,7,7-trifluoro-6-hydroxy-2-methyl-6-(trifluoromethyl)hept-2-enoate |
| SMILES | CC(=CC(CC(O)(C(F)(F)F)C(F)(F)F)C1CCCCC1)C(=O)[O-] |
| InChI | InChI=1S/C15H20F6O3/c1-9(12(22)23)7-11(10-5-3-2-4-6-10)8-13(24,14(16,17)18)15(19,20)21/h7,10-11,24H,2-6,8H2,1H3,(H,22,23)/p-1 |
| InChIKey | ATLNAQPANGLXJF-UHFFFAOYSA-M |
| XLogP | 3.12 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|