C11H18F4 — CID 70821112
(1,3,3,3-tetrafluoro-2,2-dimethylpropyl)cyclohexane (PubChem CID 70821112) has the molecular formula C11H18F4 and a molecular weight of 226.26 g/mol. Its IUPAC name is (1,3,3,3-tetrafluoro-2,2-dimethylpropyl)cyclohexane.
| Compound Name | (1,3,3,3-tetrafluoro-2,2-dimethylpropyl)cyclohexane |
|---|---|
| PubChem CID | 70821112 |
| Molecular Formula | C11H18F4 |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (1,3,3,3-tetrafluoro-2,2-dimethylpropyl)cyclohexane |
| SMILES | CC(C)(C(F)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H18F4/c1-10(2,11(13,14)15)9(12)8-6-4-3-5-7-8/h8-9H,3-7H2,1-2H3 |
| InChIKey | AJQHILQMBDWZOW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |