C27H56 — CID 159588674
3-tert-butyl-2,2,4,4-tetramethylpentane;2,2,4,4-tetramethylpentan-3-ylcyclopentane (PubChem CID 159588674) has the molecular formula C27H56 and a molecular weight of 380.75 g/mol. Its IUPAC name is 3-tert-butyl-2,2,4,4-tetramethylpentane;2,2,4,4-tetramethylpentan-3-ylcyclopentane.
| Compound Name | 3-tert-butyl-2,2,4,4-tetramethylpentane;2,2,4,4-tetramethylpentan-3-ylcyclopentane |
|---|---|
| PubChem CID | 159588674 |
| Molecular Formula | C27H56 |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 380.44 |
| IUPAC Name | 3-tert-butyl-2,2,4,4-tetramethylpentane;2,2,4,4-tetramethylpentan-3-ylcyclopentane |
| SMILES | CC(C)(C)C(C(C)(C)C)C(C)(C)C.CC(C)(C)C(C1CCCC1)C(C)(C)C |
| InChI | InChI=1S/C14H28.C13H28/c1-13(2,3)12(14(4,5)6)11-9-7-8-10-11;1-11(2,3)10(12(4,5)6)13(7,8)9/h11-12H,7-10H2,1-6H3;10H,1-9H3 |
| InChIKey | MJYLTERMOCQPCZ-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |