About (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate
(4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate (PubChem CID 129164229) has the molecular formula C11H13I2NO3
and a molecular weight of 461.04 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate |
| PubChem CID | 129164229 |
| Molecular Formula | C11H13I2NO3 |
| Molecular Weight | 461.04 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate |
| SMILES | CC(NI)C(C)(I)C(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C11H13I2NO3/c1-7(14-13)11(2,12)10(16)17-9-5-3-8(15)4-6-9/h3-7,14-15H,1-2H3 |
| InChIKey | HJLBYBZLPPEGTE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.04 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate?
The IUPAC name of (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate (CID 129164229) is (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate.
What is the SMILES notation for (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate?
The canonical SMILES for (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate is CC(NI)C(C)(I)C(=O)Oc1ccc(O)cc1.
What is the InChIKey of (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate?
The InChIKey is HJLBYBZLPPEGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13I2NO3/c1-7(14-13)11(2,12)10(16)17-9-5-3-8(15)4-6-9/h3-7,14-15H,1-2H3.
What are the key properties of (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate?
(4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate has a molecular weight of 461.04 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl) 2-iodo-3-(iodoamino)-2-methylbutanoate is sourced from PubChem (CID 129164229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).