C11H11IN2O3 — CID 129145644
(4-hydroxyphenyl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodopropanoate (PubChem CID 129145644) has the molecular formula C11H11IN2O3 and a molecular weight of 346.12 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodopropanoate.
| Compound Name | (4-hydroxyphenyl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodopropanoate |
|---|---|
| PubChem CID | 129145644 |
| Molecular Formula | C11H11IN2O3 |
| Molecular Weight | 346.12 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | (4-hydroxyphenyl) 2-(2,4-diazabicyclo[1.1.0]butan-1-yl)-2-iodopropanoate |
| SMILES | CC(I)(C(=O)Oc1ccc(O)cc1)C12NC1N2 |
| InChI | InChI=1S/C11H11IN2O3/c1-10(12,11-8(13-11)14-11)9(16)17-7-4-2-6(15)3-5-7/h2-5,8,13-15H,1H3 |
| InChIKey | IIYBZYYODFHDHC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.12 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|