C10H10F3NO4 — CID 123719010
[4-(hydroxyamino)phenyl] 1,1,1-trifluoropropan-2-yl carbonate (PubChem CID 123719010) has the molecular formula C10H10F3NO4 and a molecular weight of 265.19 g/mol. Its IUPAC name is [4-(hydroxyamino)phenyl] 1,1,1-trifluoropropan-2-yl carbonate.
| Compound Name | [4-(hydroxyamino)phenyl] 1,1,1-trifluoropropan-2-yl carbonate |
|---|---|
| PubChem CID | 123719010 |
| Molecular Formula | C10H10F3NO4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | [4-(hydroxyamino)phenyl] 1,1,1-trifluoropropan-2-yl carbonate |
| SMILES | CC(OC(=O)Oc1ccc(NO)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO4/c1-6(10(11,12)13)17-9(15)18-8-4-2-7(14-16)3-5-8/h2-6,14,16H,1H3 |
| InChIKey | POIWXIPCAFPIIP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|