About [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate
[2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate (PubChem CID 89282458) has the molecular formula C18H18O7
and a molecular weight of 346.34 g/mol. Its IUPAC name is [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate |
| PubChem CID | 89282458 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate |
| SMILES | CCOCC(OC(=O)c1ccc(O)cc1)OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H18O7/c1-2-23-11-16(24-17(21)12-3-7-14(19)8-4-12)25-18(22)13-5-9-15(20)10-6-13/h3-10,16,19-20H,2,11H2,1H3 |
| InChIKey | CNGAKUJKQLNSSP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate?
The IUPAC name of [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate (CID 89282458) is [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate.
What is the SMILES notation for [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate?
The canonical SMILES for [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate is CCOCC(OC(=O)c1ccc(O)cc1)OC(=O)c1ccc(O)cc1.
What is the InChIKey of [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate?
The InChIKey is CNGAKUJKQLNSSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O7/c1-2-23-11-16(24-17(21)12-3-7-14(19)8-4-12)25-18(22)13-5-9-15(20)10-6-13/h3-10,16,19-20H,2,11H2,1H3.
What are the key properties of [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate?
[2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate has a molecular weight of 346.34 g/mol, XLogP of 2.47, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-ethoxy-1-(4-hydroxybenzoyl)oxyethyl] 4-hydroxybenzoate is sourced from PubChem (CID 89282458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).