About 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid
3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid (PubChem CID 87554570) has the molecular formula C32H22O11
and a molecular weight of 582.52 g/mol. Its IUPAC name is 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid.
Molecular Properties
| Compound Name | 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid |
| PubChem CID | 87554570 |
| Molecular Formula | C32H22O11 |
| Molecular Weight | 582.52 g/mol |
| Exact Mass | 582.12 |
| IUPAC Name | 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid |
| SMILES | O=C(OC(=O)c1ccc(Cc2ccccc2)c(C(=O)O)c1C(=O)O)c1ccc(Cc2ccccc2)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C32H22O11/c33-27(34)23-19(15-17-7-3-1-4-8-17)11-13-21(25(23)29(37)38)31(41)43-32(42)22-14-12-20(16-18-9-5-2-6-10-18)24(28(35)36)26(22)30(39)40/h1-14H,15-16H2,(H,33,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | QQEHWCXOLKMLLA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 192.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 582.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid?
The IUPAC name of 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid (CID 87554570) is 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid.
What is the SMILES notation for 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid?
The canonical SMILES for 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid is O=C(OC(=O)c1ccc(Cc2ccccc2)c(C(=O)O)c1C(=O)O)c1ccc(Cc2ccccc2)c(C(=O)O)c1C(=O)O.
What is the InChIKey of 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid?
The InChIKey is QQEHWCXOLKMLLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H22O11/c33-27(34)23-19(15-17-7-3-1-4-8-17)11-13-21(25(23)29(37)38)31(41)43-32(42)22-14-12-20(16-18-9-5-2-6-10-18)24(28(35)36)26(22)30(39)40/h1-14H,15-16H2,(H,33,34)(H,35,36)(H,37,38)(H,39,40).
What are the key properties of 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid?
3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid has a molecular weight of 582.52 g/mol, XLogP of 4.66, 10 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-6-(4-benzyl-2,3-dicarboxybenzoyl)oxycarbonylphthalic acid is sourced from PubChem (CID 87554570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).