C26H30O8 — CID 54125036
2-butoxycarbonyl-4-(5-butoxycarbonyl-4-carboxy-2-methylphenyl)-5-methylbenzoic acid (PubChem CID 54125036) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is 2-butoxycarbonyl-4-(5-butoxycarbonyl-4-carboxy-2-methylphenyl)-5-methylbenzoic acid.
| Compound Name | 2-butoxycarbonyl-4-(5-butoxycarbonyl-4-carboxy-2-methylphenyl)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 54125036 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-butoxycarbonyl-4-(5-butoxycarbonyl-4-carboxy-2-methylphenyl)-5-methylbenzoic acid |
| SMILES | CCCCOC(=O)c1cc(-c2cc(C(=O)OCCCC)c(C(=O)O)cc2C)c(C)cc1C(=O)O |
| InChI | InChI=1S/C26H30O8/c1-5-7-9-33-25(31)21-13-17(15(3)11-19(21)23(27)28)18-14-22(26(32)34-10-8-6-2)20(24(29)30)12-16(18)4/h11-14H,5-10H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | NQIQTSPSHSPBPG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|