C14H14O8S2 — CID 126540786
4,5-bis(2-sulfanylethoxycarbonyl)phthalic acid (PubChem CID 126540786) has the molecular formula C14H14O8S2 and a molecular weight of 374.39 g/mol. Its IUPAC name is 4,5-bis(2-sulfanylethoxycarbonyl)phthalic acid.
| Compound Name | 4,5-bis(2-sulfanylethoxycarbonyl)phthalic acid |
|---|---|
| PubChem CID | 126540786 |
| Molecular Formula | C14H14O8S2 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 4,5-bis(2-sulfanylethoxycarbonyl)phthalic acid |
| SMILES | O=C(O)c1cc(C(=O)OCCS)c(C(=O)OCCS)cc1C(=O)O |
| InChI | InChI=1S/C14H14O8S2/c15-11(16)7-5-9(13(19)21-1-3-23)10(6-8(7)12(17)18)14(20)22-2-4-24/h5-6,23-24H,1-4H2,(H,15,16)(H,17,18) |
| InChIKey | BORFGJOMZPVMSZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|