C20H29ClO4 — CID 139911680
4-chloro-5-ethyl-2-(2-methylnonan-5-yloxycarbonyl)benzoic acid (PubChem CID 139911680) has the molecular formula C20H29ClO4 and a molecular weight of 368.90 g/mol. Its IUPAC name is 4-chloro-5-ethyl-2-(2-methylnonan-5-yloxycarbonyl)benzoic acid.
| Compound Name | 4-chloro-5-ethyl-2-(2-methylnonan-5-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 139911680 |
| Molecular Formula | C20H29ClO4 |
| Molecular Weight | 368.90 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4-chloro-5-ethyl-2-(2-methylnonan-5-yloxycarbonyl)benzoic acid |
| SMILES | CCCCC(CCC(C)C)OC(=O)c1cc(Cl)c(CC)cc1C(=O)O |
| InChI | InChI=1S/C20H29ClO4/c1-5-7-8-15(10-9-13(3)4)25-20(24)17-12-18(21)14(6-2)11-16(17)19(22)23/h11-13,15H,5-10H2,1-4H3,(H,22,23) |
| InChIKey | SCSMQJVOWJOHES-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.90 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |