C26H41ClO4 — CID 69124828
bis(6-methylheptan-3-yl) 4-chloro-5-ethylbenzene-1,2-dicarboxylate (PubChem CID 69124828) has the molecular formula C26H41ClO4 and a molecular weight of 453.06 g/mol. Its IUPAC name is bis(6-methylheptan-3-yl) 4-chloro-5-ethylbenzene-1,2-dicarboxylate.
| Compound Name | bis(6-methylheptan-3-yl) 4-chloro-5-ethylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69124828 |
| Molecular Formula | C26H41ClO4 |
| Molecular Weight | 453.06 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | bis(6-methylheptan-3-yl) 4-chloro-5-ethylbenzene-1,2-dicarboxylate |
| SMILES | CCc1cc(C(=O)OC(CC)CCC(C)C)c(C(=O)OC(CC)CCC(C)C)cc1Cl |
| InChI | InChI=1S/C26H41ClO4/c1-8-19-15-22(25(28)30-20(9-2)13-11-17(4)5)23(16-24(19)27)26(29)31-21(10-3)14-12-18(6)7/h15-18,20-21H,8-14H2,1-7H3 |
| InChIKey | QDTIDWUBDCXBPN-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.06 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |