C17H23BrO4 — CID 69124413
5-bromo-4-methyl-2-(2-methylheptan-3-yloxycarbonyl)benzoic acid (PubChem CID 69124413) has the molecular formula C17H23BrO4 and a molecular weight of 371.27 g/mol. Its IUPAC name is 5-bromo-4-methyl-2-(2-methylheptan-3-yloxycarbonyl)benzoic acid.
| Compound Name | 5-bromo-4-methyl-2-(2-methylheptan-3-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 69124413 |
| Molecular Formula | C17H23BrO4 |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 5-bromo-4-methyl-2-(2-methylheptan-3-yloxycarbonyl)benzoic acid |
| SMILES | CCCCC(OC(=O)c1cc(C)c(Br)cc1C(=O)O)C(C)C |
| InChI | InChI=1S/C17H23BrO4/c1-5-6-7-15(10(2)3)22-17(21)13-8-11(4)14(18)9-12(13)16(19)20/h8-10,15H,5-7H2,1-4H3,(H,19,20) |
| InChIKey | MLNRUKKRLOQWDT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |