C15H20Br2O — CID 81468373
1-(2,5-dibromo-4-methylphenyl)-2-ethylhexan-1-one (PubChem CID 81468373) has the molecular formula C15H20Br2O and a molecular weight of 376.13 g/mol. Its IUPAC name is 1-(2,5-dibromo-4-methylphenyl)-2-ethylhexan-1-one.
| Compound Name | 1-(2,5-dibromo-4-methylphenyl)-2-ethylhexan-1-one |
|---|---|
| PubChem CID | 81468373 |
| Molecular Formula | C15H20Br2O |
| Molecular Weight | 376.13 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 1-(2,5-dibromo-4-methylphenyl)-2-ethylhexan-1-one |
| SMILES | CCCCC(CC)C(=O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C15H20Br2O/c1-4-6-7-11(5-2)15(18)12-9-13(16)10(3)8-14(12)17/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | ULBOMQNGPIMZPL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.13 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |