2-methylheptan-3-yl hydrogen carbonate

C9H18O3 — CID 87132104

IUPAC2-methylheptan-3-yl hydrogen carbonate
SMILESCCCCC(OC(=O)O)C(C)C
InChIInChI=1S/C9H18O3/c1-4-5-6-8(7(2)3)12-9(10)11/h7-8H,4-6H2,1-3H3,(H,10,11)
InChIKeyDTNJICVUDKTVNC-UHFFFAOYSA-N
MW174.24 g/mol
LogP2.90
Rot. Bonds5

About 2-methylheptan-3-yl hydrogen carbonate

2-methylheptan-3-yl hydrogen carbonate (PubChem CID 87132104) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-methylheptan-3-yl hydrogen carbonate.

Molecular Properties

Compound Name2-methylheptan-3-yl hydrogen carbonate
PubChem CID87132104
Molecular FormulaC9H18O3
Molecular Weight174.24 g/mol
Exact Mass174.13
IUPAC Name2-methylheptan-3-yl hydrogen carbonate
SMILESCCCCC(OC(=O)O)C(C)C
InChIInChI=1S/C9H18O3/c1-4-5-6-8(7(2)3)12-9(10)11/h7-8H,4-6H2,1-3H3,(H,10,11)
InChIKeyDTNJICVUDKTVNC-UHFFFAOYSA-N
XLogP2.90
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.24
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-methylheptan-3-yl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylheptan-3-yl hydrogen carbonate?
The IUPAC name of 2-methylheptan-3-yl hydrogen carbonate (CID 87132104) is 2-methylheptan-3-yl hydrogen carbonate.
What is the SMILES notation for 2-methylheptan-3-yl hydrogen carbonate?
The canonical SMILES for 2-methylheptan-3-yl hydrogen carbonate is CCCCC(OC(=O)O)C(C)C.
What is the InChIKey of 2-methylheptan-3-yl hydrogen carbonate?
The InChIKey is DTNJICVUDKTVNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3/c1-4-5-6-8(7(2)3)12-9(10)11/h7-8H,4-6H2,1-3H3,(H,10,11).
What are the key properties of 2-methylheptan-3-yl hydrogen carbonate?
2-methylheptan-3-yl hydrogen carbonate has a molecular weight of 174.24 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptan-3-yl hydrogen carbonate is sourced from PubChem (CID 87132104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).